C16H22O6 — CID 5536
View drug profile → trepibutone4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid (PubChem CID 5536) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid.
| Compound Name | 4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 5536 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid |
| SMILES | CCOc1cc(OCC)c(C(=O)CCC(=O)O)cc1OCC |
| InChI | InChI=1S/C16H22O6/c1-4-20-13-10-15(22-6-3)14(21-5-2)9-11(13)12(17)7-8-16(18)19/h9-10H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | YPTFHLJNWSJXKG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |