C6H9NO3 — CID 5576
View drug profile → trimethadione3,5,5-trimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 5576) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 5576 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CN1C(=O)OC(C)(C)C1=O |
| InChI | InChI=1S/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
| InChIKey | IRYJRGCIQBGHIV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |