C13H8N6 — CID 5288320
View drug profile → topiroxostat4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine-2-carbonitrile (PubChem CID 5288320) has the molecular formula C13H8N6 and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 5288320 |
| Molecular Formula | C13H8N6 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(-c2n[nH]c(-c3ccncc3)n2)ccn1 |
| InChI | InChI=1S/C13H8N6/c14-8-11-7-10(3-6-16-11)13-17-12(18-19-13)9-1-4-15-5-2-9/h1-7H,(H,17,18,19) |
| InChIKey | UBVZQGOVTLIHLH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |