About methylsulfinylmethane
methylsulfinylmethane (PubChem CID 679) has the molecular formula C2H6OS
and a molecular weight of 78.14 g/mol. Its IUPAC name is methylsulfinylmethane.
Molecular Properties
| Compound Name | methylsulfinylmethane |
| PubChem CID | 679 |
| Molecular Formula | C2H6OS |
| Molecular Weight | 78.14 g/mol |
| Exact Mass | 78.01 |
| IUPAC Name | methylsulfinylmethane |
| SMILES | CS(C)=O |
| InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| InChIKey | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane?
The IUPAC name of methylsulfinylmethane (CID 679) is methylsulfinylmethane.
What is the SMILES notation for methylsulfinylmethane?
The canonical SMILES for methylsulfinylmethane is CS(C)=O.
What is the InChIKey of methylsulfinylmethane?
The InChIKey is IAZDPXIOMUYVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS/c1-4(2)3/h1-2H3.
What are the key properties of methylsulfinylmethane?
methylsulfinylmethane has a molecular weight of 78.14 g/mol, XLogP of -0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane is sourced from PubChem (CID 679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).