About propane-1,2-diol
propane-1,2-diol (PubChem CID 1030) has the molecular formula C3H8O2
and a molecular weight of 76.10 g/mol. Its IUPAC name is propane-1,2-diol.
Molecular Properties
| Compound Name | propane-1,2-diol |
| PubChem CID | 1030 |
| Molecular Formula | C3H8O2 |
| Molecular Weight | 76.10 g/mol |
| Exact Mass | 76.05 |
| IUPAC Name | propane-1,2-diol |
| SMILES | CC(O)CO |
| InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
| InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.10 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol?
The IUPAC name of propane-1,2-diol (CID 1030) is propane-1,2-diol.
What is the SMILES notation for propane-1,2-diol?
The canonical SMILES for propane-1,2-diol is CC(O)CO.
What is the InChIKey of propane-1,2-diol?
The InChIKey is DNIAPMSPPWPWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3.
What are the key properties of propane-1,2-diol?
propane-1,2-diol has a molecular weight of 76.10 g/mol, XLogP of -0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol is sourced from PubChem (CID 1030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).