About 1-phenylethanol
1-phenylethanol (PubChem CID 7409) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-phenylethanol.
Molecular Properties
| Compound Name | 1-phenylethanol |
| PubChem CID | 7409 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1-phenylethanol |
| SMILES | CC(O)c1ccccc1 |
| InChI | InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| InChIKey | WAPNOHKVXSQRPX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanol?
The IUPAC name of 1-phenylethanol (CID 7409) is 1-phenylethanol.
What is the SMILES notation for 1-phenylethanol?
The canonical SMILES for 1-phenylethanol is CC(O)c1ccccc1.
What is the InChIKey of 1-phenylethanol?
The InChIKey is WAPNOHKVXSQRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3.
What are the key properties of 1-phenylethanol?
1-phenylethanol has a molecular weight of 122.17 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanol is sourced from PubChem (CID 7409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).