About 1-phenylpiperazine
1-phenylpiperazine (PubChem CID 7096) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-phenylpiperazine.
Molecular Properties
| Compound Name | 1-phenylpiperazine |
| PubChem CID | 7096 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-phenylpiperazine |
| SMILES | c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C10H14N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h1-5,11H,6-9H2 |
| InChIKey | YZTJYBJCZXZGCT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpiperazine?
The IUPAC name of 1-phenylpiperazine (CID 7096) is 1-phenylpiperazine.
What is the SMILES notation for 1-phenylpiperazine?
The canonical SMILES for 1-phenylpiperazine is c1ccc(N2CCNCC2)cc1.
What is the InChIKey of 1-phenylpiperazine?
The InChIKey is YZTJYBJCZXZGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h1-5,11H,6-9H2.
What are the key properties of 1-phenylpiperazine?
1-phenylpiperazine has a molecular weight of 162.24 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpiperazine is sourced from PubChem (CID 7096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).