C27H26N4O2 — CID 10003251
N-[3-[4-[(4-methoxyphenyl)methyl-methylamino]pyrimidin-2-yl]phenyl]-4-methylbenzamide (PubChem CID 10003251) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[3-[4-[(4-methoxyphenyl)methyl-methylamino]pyrimidin-2-yl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[4-[(4-methoxyphenyl)methyl-methylamino]pyrimidin-2-yl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 10003251 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[3-[4-[(4-methoxyphenyl)methyl-methylamino]pyrimidin-2-yl]phenyl]-4-methylbenzamide |
| SMILES | COc1ccc(CN(C)c2ccnc(-c3cccc(NC(=O)c4ccc(C)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C27H26N4O2/c1-19-7-11-21(12-8-19)27(32)29-23-6-4-5-22(17-23)26-28-16-15-25(30-26)31(2)18-20-9-13-24(33-3)14-10-20/h4-17H,18H2,1-3H3,(H,29,32) |
| InChIKey | SUFOHBGTVXCDEP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |