C21H37N2+ — CID 10003563
3-[(2S)-1-methylpyrrolidin-2-yl]-1-undecylpyridin-1-ium (PubChem CID 10003563) has the molecular formula C21H37N2+ and a molecular weight of 317.54 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]-1-undecylpyridin-1-ium.
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1-undecylpyridin-1-ium |
|---|---|
| PubChem CID | 10003563 |
| Molecular Formula | C21H37N2+ |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.30 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1-undecylpyridin-1-ium |
| SMILES | CCCCCCCCCCC[n+]1cccc([C@@H]2CCCN2C)c1 |
| InChI | InChI=1S/C21H37N2/c1-3-4-5-6-7-8-9-10-11-17-23-18-12-14-20(19-23)21-15-13-16-22(21)2/h12,14,18-19,21H,3-11,13,15-17H2,1-2H3/q+1/t21-/m0/s1 |
| InChIKey | FJPLXMBBKQBWSK-NRFANRHFSA-N |
| XLogP | 5.27 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|