C17H29IN2 — CID 10045781
1-heptyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium iodide (PubChem CID 10045781) has the molecular formula C17H29IN2 and a molecular weight of 388.34 g/mol. Its IUPAC name is 1-heptyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium iodide.
| Compound Name | 1-heptyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 10045781 |
| Molecular Formula | C17H29IN2 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-heptyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium iodide |
| SMILES | CCCCCCC[n+]1cccc([C@@H]2CCCN2C)c1.[I-] |
| InChI | InChI=1S/C17H29N2.HI/c1-3-4-5-6-7-13-19-14-8-10-16(15-19)17-11-9-12-18(17)2;/h8,10,14-15,17H,3-7,9,11-13H2,1-2H3;1H/q+1;/p-1/t17-;/m0./s1 |
| InChIKey | HIMTZIDUCJISMI-LMOVPXPDSA-M |
| XLogP | 0.72 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|