C20H35N2+ — CID 10025699
1-decyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium (PubChem CID 10025699) has the molecular formula C20H35N2+ and a molecular weight of 303.51 g/mol. Its IUPAC name is 1-decyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium.
| Compound Name | 1-decyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 10025699 |
| Molecular Formula | C20H35N2+ |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.28 |
| IUPAC Name | 1-decyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium |
| SMILES | CCCCCCCCCC[n+]1cccc([C@@H]2CCCN2C)c1 |
| InChI | InChI=1S/C20H35N2/c1-3-4-5-6-7-8-9-10-16-22-17-11-13-19(18-22)20-14-12-15-21(20)2/h11,13,17-18,20H,3-10,12,14-16H2,1-2H3/q+1/t20-/m0/s1 |
| InChIKey | IGRBOGLDQXBDPE-FQEVSTJZSA-N |
| XLogP | 4.88 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|