C27H36FN5O2 — CID 10005437
N-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-3-methylbutan-2-amine (PubChem CID 10005437) has the molecular formula C27H36FN5O2 and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-3-methylbutan-2-amine.
| Compound Name | N-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 10005437 |
| Molecular Formula | C27H36FN5O2 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-3-methylbutan-2-amine |
| SMILES | CC(C)C(C)NCc1cccc(OC[C@@H]2CC[C@H]3CN(c4noc5ccc(F)cc45)CCN3C2)n1 |
| InChI | InChI=1S/C27H36FN5O2/c1-18(2)19(3)29-14-22-5-4-6-26(30-22)34-17-20-7-9-23-16-33(12-11-32(23)15-20)27-24-13-21(28)8-10-25(24)35-31-27/h4-6,8,10,13,18-20,23,29H,7,9,11-12,14-17H2,1-3H3/t19?,20-,23+/m1/s1 |
| InChIKey | BMNYFQTXQPAJIT-WJJSNJRJSA-N |
| XLogP | 4.48 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |