C20H20F2N4O3S3 — CID 10006100
4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-(2-ethylsulfanylethyl)benzenesulfonamide (PubChem CID 10006100) has the molecular formula C20H20F2N4O3S3 and a molecular weight of 498.60 g/mol. Its IUPAC name is 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-(2-ethylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-(2-ethylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10006100 |
| Molecular Formula | C20H20F2N4O3S3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-(2-ethylsulfanylethyl)benzenesulfonamide |
| SMILES | CCSCCNS(=O)(=O)c1ccc(Nc2nc(N)c(C(=O)c3c(F)cccc3F)s2)cc1 |
| InChI | InChI=1S/C20H20F2N4O3S3/c1-2-30-11-10-24-32(28,29)13-8-6-12(7-9-13)25-20-26-19(23)18(31-20)17(27)16-14(21)4-3-5-15(16)22/h3-9,24H,2,10-11,23H2,1H3,(H,25,26) |
| InChIKey | HWBNOHWJPKPJAB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|