C23H24F2N4O3S — CID 20590577
tert-butyl 2-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-methylanilino]acetate (PubChem CID 20590577) has the molecular formula C23H24F2N4O3S and a molecular weight of 474.53 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-methylanilino]acetate.
| Compound Name | tert-butyl 2-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-methylanilino]acetate |
|---|---|
| PubChem CID | 20590577 |
| Molecular Formula | C23H24F2N4O3S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | tert-butyl 2-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]-N-methylanilino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)c1ccc(Nc2nc(N)c(C(=O)c3c(F)cccc3F)s2)cc1 |
| InChI | InChI=1S/C23H24F2N4O3S/c1-23(2,3)32-17(30)12-29(4)14-10-8-13(9-11-14)27-22-28-21(26)20(33-22)19(31)18-15(24)6-5-7-16(18)25/h5-11H,12,26H2,1-4H3,(H,27,28) |
| InChIKey | CYFXHRIQPSMWHN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|