C30H30O7 — CID 10006248
5-[2-[3-[2-hydroxy-6-[2-(4-hydroxyphenyl)ethyl]phenoxy]phenyl]-1-methoxyethyl]-3-methoxybenzene-1,2-diol (PubChem CID 10006248) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is 5-[2-[3-[2-hydroxy-6-[2-(4-hydroxyphenyl)ethyl]phenoxy]phenyl]-1-methoxyethyl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[2-[3-[2-hydroxy-6-[2-(4-hydroxyphenyl)ethyl]phenoxy]phenyl]-1-methoxyethyl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 10006248 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 5-[2-[3-[2-hydroxy-6-[2-(4-hydroxyphenyl)ethyl]phenoxy]phenyl]-1-methoxyethyl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(C(Cc2cccc(Oc3c(O)cccc3CCc3ccc(O)cc3)c2)OC)cc(O)c1O |
| InChI | InChI=1S/C30H30O7/c1-35-27(22-17-26(33)29(34)28(18-22)36-2)16-20-5-3-7-24(15-20)37-30-21(6-4-8-25(30)32)12-9-19-10-13-23(31)14-11-19/h3-8,10-11,13-15,17-18,27,31-34H,9,12,16H2,1-2H3 |
| InChIKey | ZEFQIOKOILPWNA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|