C30H33ClN4O3 — CID 10007264
N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 10007264) has the molecular formula C30H33ClN4O3 and a molecular weight of 533.07 g/mol. Its IUPAC name is N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 10007264 |
| Molecular Formula | C30H33ClN4O3 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C30H33ClN4O3/c31-20-14-15-24-26(18-20)34-25-13-7-6-12-23(25)28(24)33-17-9-3-1-2-8-16-32-27(36)19-35-29(37)21-10-4-5-11-22(21)30(35)38/h4-5,10-11,14-15,18H,1-3,6-9,12-13,16-17,19H2,(H,32,36)(H,33,34) |
| InChIKey | CMAUFICHSLSADI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|