About 2-butyl-1H-phthalazine
2-butyl-1H-phthalazine (PubChem CID 10012707) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-butyl-1H-phthalazine.
Molecular Properties
| Compound Name | 2-butyl-1H-phthalazine |
| PubChem CID | 10012707 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-butyl-1H-phthalazine |
| SMILES | CCCCN1Cc2ccccc2C=N1 |
| InChI | InChI=1S/C12H16N2/c1-2-3-8-14-10-12-7-5-4-6-11(12)9-13-14/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | DLZKHQJLDALMQW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1H-phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-phthalazine?
The IUPAC name of 2-butyl-1H-phthalazine (CID 10012707) is 2-butyl-1H-phthalazine.
What is the SMILES notation for 2-butyl-1H-phthalazine?
The canonical SMILES for 2-butyl-1H-phthalazine is CCCCN1Cc2ccccc2C=N1.
What is the InChIKey of 2-butyl-1H-phthalazine?
The InChIKey is DLZKHQJLDALMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-2-3-8-14-10-12-7-5-4-6-11(12)9-13-14/h4-7,9H,2-3,8,10H2,1H3.
What are the key properties of 2-butyl-1H-phthalazine?
2-butyl-1H-phthalazine has a molecular weight of 188.27 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-phthalazine is sourced from PubChem (CID 10012707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).