C13H14N4 — CID 10013930
2-(5-butyl-1H-1,2,4-triazol-3-yl)benzonitrile (PubChem CID 10013930) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(5-butyl-1H-1,2,4-triazol-3-yl)benzonitrile.
| Compound Name | 2-(5-butyl-1H-1,2,4-triazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 10013930 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-(5-butyl-1H-1,2,4-triazol-3-yl)benzonitrile |
| SMILES | CCCCc1nc(-c2ccccc2C#N)n[nH]1 |
| InChI | InChI=1S/C13H14N4/c1-2-3-8-12-15-13(17-16-12)11-7-5-4-6-10(11)9-14/h4-7H,2-3,8H2,1H3,(H,15,16,17) |
| InChIKey | OGVLLKCZUVWCRS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |