C18H16N2 — CID 10015480
5-(4-methylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 10015480) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 5-(4-methylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 10015480 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-(4-methylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | Cc1ccc(C2=Cc3ccccc3C3=NCCN23)cc1 |
| InChI | InChI=1S/C18H16N2/c1-13-6-8-14(9-7-13)17-12-15-4-2-3-5-16(15)18-19-10-11-20(17)18/h2-9,12H,10-11H2,1H3 |
| InChIKey | CMJCEGZQDMAHMN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|