C19H18N+ — CID 10015484
1-azoniapentacyclo[10.7.1.01,6.08,20.014,19]icosa-6,8(20),9,11,13,15,17-heptaene (PubChem CID 10015484) has the molecular formula C19H18N+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-azoniapentacyclo[10.7.1.01,6.08,20.014,19]icosa-6,8(20),9,11,13,15,17-heptaene.
| Compound Name | 1-azoniapentacyclo[10.7.1.01,6.08,20.014,19]icosa-6,8(20),9,11,13,15,17-heptaene |
|---|---|
| PubChem CID | 10015484 |
| Molecular Formula | C19H18N+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-azoniapentacyclo[10.7.1.01,6.08,20.014,19]icosa-6,8(20),9,11,13,15,17-heptaene |
| SMILES | C1=CC2=Cc3cccc4c3[N+]3(CCCCC3=C4)C2C=C1 |
| InChI | InChI=1S/C19H18N/c1-2-10-18-14(6-1)12-15-7-5-8-16-13-17-9-3-4-11-20(17,18)19(15)16/h1-2,5-8,10,12-13,18H,3-4,9,11H2/q+1 |
| InChIKey | JOIRQXMSIDEJQX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|