C7H7NO2S — CID 88529047
1-hydroxy-1-oxido-7aH-2,1-benzothiazol-1-ium (PubChem CID 88529047) has the molecular formula C7H7NO2S and a molecular weight of 169.21 g/mol. Its IUPAC name is 1-hydroxy-1-oxido-7aH-2,1-benzothiazol-1-ium.
| Compound Name | 1-hydroxy-1-oxido-7aH-2,1-benzothiazol-1-ium |
|---|---|
| PubChem CID | 88529047 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 1-hydroxy-1-oxido-7aH-2,1-benzothiazol-1-ium |
| SMILES | [O-][N+]1(O)SC=C2C=CC=CC21 |
| InChI | InChI=1S/C7H7NO2S/c9-8(10)7-4-2-1-3-6(7)5-11-8/h1-5,7,9H |
| InChIKey | CWKSBUMQQAMCFR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|