C19H17NO2 — CID 10017165
6,6,12-trimethylisochromeno[4,3-c]quinolin-11-one (PubChem CID 10017165) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6,6,12-trimethylisochromeno[4,3-c]quinolin-11-one.
| Compound Name | 6,6,12-trimethylisochromeno[4,3-c]quinolin-11-one |
|---|---|
| PubChem CID | 10017165 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 6,6,12-trimethylisochromeno[4,3-c]quinolin-11-one |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C19H17NO2/c1-19(2)14-10-6-4-8-12(14)16-17(22-19)13-9-5-7-11-15(13)20(3)18(16)21/h4-11H,1-3H3 |
| InChIKey | OSJFEQKUWOUWHV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |