C13H12N2S3 — CID 10017235
benzyl N-[(E)-thiophen-2-ylmethylideneamino]carbamodithioate (PubChem CID 10017235) has the molecular formula C13H12N2S3 and a molecular weight of 292.45 g/mol. Its IUPAC name is benzyl N-[(E)-thiophen-2-ylmethylideneamino]carbamodithioate.
| Compound Name | benzyl N-[(E)-thiophen-2-ylmethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 10017235 |
| Molecular Formula | C13H12N2S3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | benzyl N-[(E)-thiophen-2-ylmethylideneamino]carbamodithioate |
| SMILES | S=C(N/N=C/c1cccs1)SCc1ccccc1 |
| InChI | InChI=1S/C13H12N2S3/c16-13(15-14-9-12-7-4-8-17-12)18-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,15,16)/b14-9+ |
| InChIKey | UGADSIVVHNSACB-NTEUORMPSA-N |
| XLogP | 3.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|