C18H17N3S2 — CID 74766088
benzyl N-[(E)-(1-methylindol-2-yl)methylideneamino]carbamodithioate (PubChem CID 74766088) has the molecular formula C18H17N3S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is benzyl N-[(E)-(1-methylindol-2-yl)methylideneamino]carbamodithioate.
| Compound Name | benzyl N-[(E)-(1-methylindol-2-yl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 74766088 |
| Molecular Formula | C18H17N3S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | benzyl N-[(E)-(1-methylindol-2-yl)methylideneamino]carbamodithioate |
| SMILES | Cn1c(/C=N/NC(=S)SCc2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C18H17N3S2/c1-21-16(11-15-9-5-6-10-17(15)21)12-19-20-18(22)23-13-14-7-3-2-4-8-14/h2-12H,13H2,1H3,(H,20,22)/b19-12+ |
| InChIKey | REXKRGBLVXXDNJ-XDHOZWIPSA-N |
| XLogP | 4.32 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|