C17H15N3S2 — CID 177421605
benzyl N-[(E)-1H-indol-7-ylmethylideneamino]carbamodithioate (PubChem CID 177421605) has the molecular formula C17H15N3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is benzyl N-[(E)-1H-indol-7-ylmethylideneamino]carbamodithioate.
| Compound Name | benzyl N-[(E)-1H-indol-7-ylmethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 177421605 |
| Molecular Formula | C17H15N3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | benzyl N-[(E)-1H-indol-7-ylmethylideneamino]carbamodithioate |
| SMILES | S=C(N/N=C/c1cccc2cc[nH]c12)SCc1ccccc1 |
| InChI | InChI=1S/C17H15N3S2/c21-17(22-12-13-5-2-1-3-6-13)20-19-11-15-8-4-7-14-9-10-18-16(14)15/h1-11,18H,12H2,(H,20,21)/b19-11+ |
| InChIKey | UOABWJJQOZBQNZ-YBFXNURJSA-N |
| XLogP | 4.31 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|