C17H13N3O3S2 — CID 135572066
(1,3-dioxoisoindol-2-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate (PubChem CID 135572066) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 135572066 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate |
| SMILES | O=C1c2ccccc2C(=O)N1CSC(=S)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C17H13N3O3S2/c21-14-8-4-1-5-11(14)9-18-19-17(24)25-10-20-15(22)12-6-2-3-7-13(12)16(20)23/h1-9,21H,10H2,(H,19,24)/b18-9+ |
| InChIKey | VSGKXTCJKPSQMT-GIJQJNRQSA-N |
| XLogP | 2.59 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|