C19H23N3O3S2 — CID 135570866
(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate (PubChem CID 135570866) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate.
| Compound Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 135570866 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(E)-(2-hydroxyphenyl)methylideneamino]carbamodithioate |
| SMILES | CC12CCC(C(=O)N(CSC(=S)N/N=C/c3ccccc3O)C1=O)C2(C)C |
| InChI | InChI=1S/C19H23N3O3S2/c1-18(2)13-8-9-19(18,3)16(25)22(15(13)24)11-27-17(26)21-20-10-12-6-4-5-7-14(12)23/h4-7,10,13,23H,8-9,11H2,1-3H3,(H,21,26)/b20-10+ |
| InChIKey | GUQWXWVNQLUMDV-KEBDBYFISA-N |
| XLogP | 3.10 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|