C13H13N3O2S2 — CID 171975842
(2,5-dioxopyrrolidin-1-yl)methyl N-[(E)-benzylideneamino]carbamodithioate (PubChem CID 171975842) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)methyl N-[(E)-benzylideneamino]carbamodithioate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)methyl N-[(E)-benzylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 171975842 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)methyl N-[(E)-benzylideneamino]carbamodithioate |
| SMILES | O=C1CCC(=O)N1CSC(=S)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C13H13N3O2S2/c17-11-6-7-12(18)16(11)9-20-13(19)15-14-8-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,15,19)/b14-8+ |
| InChIKey | DXGZHDVHHKWGFC-RIYZIHGNSA-N |
| XLogP | 1.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|