C20H25N3O2S2 — CID 171975839
(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(Z)-1-phenylethylideneamino]carbamodithioate (PubChem CID 171975839) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(Z)-1-phenylethylideneamino]carbamodithioate.
| Compound Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(Z)-1-phenylethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 171975839 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(Z)-1-phenylethylideneamino]carbamodithioate |
| SMILES | C/C(=N/NC(=S)SCN1C(=O)C2CCC(C)(C1=O)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S2/c1-13(14-8-6-5-7-9-14)21-22-18(26)27-12-23-16(24)15-10-11-20(4,17(23)25)19(15,2)3/h5-9,15H,10-12H2,1-4H3,(H,22,26)/b21-13- |
| InChIKey | FMUWENLUBOGWBZ-BKUYFWCQSA-N |
| XLogP | 3.79 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|