C22H27N3O2S2 — CID 9497722
[(1S,5R)-1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl]methyl N-[(Z)-[(Z)-4-phenylbut-3-en-2-ylidene]amino]carbamodithioate (PubChem CID 9497722) has the molecular formula C22H27N3O2S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is [(1S,5R)-1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl]methyl N-[(Z)-[(Z)-4-phenylbut-3-en-2-ylidene]amino]carbamodithioate.
| Compound Name | [(1S,5R)-1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl]methyl N-[(Z)-[(Z)-4-phenylbut-3-en-2-ylidene]amino]carbamodithioate |
|---|---|
| PubChem CID | 9497722 |
| Molecular Formula | C22H27N3O2S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [(1S,5R)-1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl]methyl N-[(Z)-[(Z)-4-phenylbut-3-en-2-ylidene]amino]carbamodithioate |
| SMILES | CC(/C=C\c1ccccc1)=N/NC(=S)SCN1C(=O)[C@@H]2CC[C@](C)(C1=O)C2(C)C |
| InChI | InChI=1S/C22H27N3O2S2/c1-15(10-11-16-8-6-5-7-9-16)23-24-20(28)29-14-25-18(26)17-12-13-22(4,19(25)27)21(17,2)3/h5-11,17H,12-14H2,1-4H3,(H,24,28)/b11-10-,23-15-/t17-,22+/m0/s1 |
| InChIKey | BSDWPQGOMMDYPO-FUVNASIXSA-N |
| XLogP | 4.45 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|