C18H18N4S4 — CID 139058629
benzyl N-[(E)-[(2E)-2-(benzylsulfanylcarbothioylhydrazinylidene)ethylidene]amino]carbamodithioate (PubChem CID 139058629) has the molecular formula C18H18N4S4 and a molecular weight of 418.64 g/mol. Its IUPAC name is benzyl N-[(E)-[(2E)-2-(benzylsulfanylcarbothioylhydrazinylidene)ethylidene]amino]carbamodithioate.
| Compound Name | benzyl N-[(E)-[(2E)-2-(benzylsulfanylcarbothioylhydrazinylidene)ethylidene]amino]carbamodithioate |
|---|---|
| PubChem CID | 139058629 |
| Molecular Formula | C18H18N4S4 |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | benzyl N-[(E)-[(2E)-2-(benzylsulfanylcarbothioylhydrazinylidene)ethylidene]amino]carbamodithioate |
| SMILES | S=C(N/N=C/C=N/NC(=S)SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C18H18N4S4/c23-17(25-13-15-7-3-1-4-8-15)21-19-11-12-20-22-18(24)26-14-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,21,23)(H,22,24)/b19-11+,20-12+ |
| InChIKey | YRCNKQKMCGTKAZ-AYKLPDECSA-N |
| XLogP | 4.57 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|