C13H20O10 — CID 10019883
2-[(2S,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxycarbonyloxyethyl 2-methylprop-2-enoate (PubChem CID 10019883) has the molecular formula C13H20O10 and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxycarbonyloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(2S,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxycarbonyloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10019883 |
| Molecular Formula | C13H20O10 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxycarbonyloxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C13H20O10/c1-6(2)11(17)20-3-4-21-13(19)23-10-8(15)7(5-14)22-12(18)9(10)16/h7-10,12,14-16,18H,1,3-5H2,2H3/t7-,8-,9-,10+,12+/m1/s1 |
| InChIKey | QMOFSRVKTGCBGC-OMHSBUABSA-N |
| XLogP | -1.94 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|