C12H22O11S — CID 67249716
sulfuric acid;2-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl 2-methylprop-2-enoate (PubChem CID 67249716) has the molecular formula C12H22O11S and a molecular weight of 374.36 g/mol. Its IUPAC name is sulfuric acid;2-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | sulfuric acid;2-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67249716 |
| Molecular Formula | C12H22O11S |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | sulfuric acid;2-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H20O7.H2O4S/c1-6(2)12(17)18-4-3-7-9(14)11(16)10(15)8(5-13)19-7;1-5(2,3)4/h7-11,13-16H,1,3-5H2,2H3;(H2,1,2,3,4)/t7?,8-,9+,10-,11-;/m1./s1 |
| InChIKey | OAMSVLBFRAVCDV-OENLYDHKSA-N |
| XLogP | -2.31 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|