C11H18O3 — CID 19101506
3-(3-ethyloxiran-2-yl)propyl 2-methylprop-2-enoate (PubChem CID 19101506) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-(3-ethyloxiran-2-yl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(3-ethyloxiran-2-yl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19101506 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-(3-ethyloxiran-2-yl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1OC1CC |
| InChI | InChI=1S/C11H18O3/c1-4-9-10(14-9)6-5-7-13-11(12)8(2)3/h9-10H,2,4-7H2,1,3H3 |
| InChIKey | VNNUVNJLRFIMFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|