C17H28O7 — CID 10020378
dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate (PubChem CID 10020378) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate.
| Compound Name | dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate |
|---|---|
| PubChem CID | 10020378 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate |
| SMILES | COC(=O)C[C@@H](OC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(=O)OC |
| InChI | InChI=1S/C17H28O7/c1-10(2)12-7-6-11(3)8-13(12)23-17(20)24-14(16(19)22-5)9-15(18)21-4/h10-14H,6-9H2,1-5H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | KOHIJQLEVHSPRS-XJFOESAGSA-N |
| XLogP | 2.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|