About dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate
dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate (PubChem CID 10020378) has the molecular formula C17H28O7
and a molecular weight of 344.40 g/mol. Its IUPAC name is dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate.
Molecular Properties
| Compound Name | dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate |
| PubChem CID | 10020378 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate |
| SMILES | COC(=O)C[C@@H](OC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(=O)OC |
| InChI | InChI=1S/C17H28O7/c1-10(2)12-7-6-11(3)8-13(12)23-17(20)24-14(16(19)22-5)9-15(18)21-4/h10-14H,6-9H2,1-5H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | KOHIJQLEVHSPRS-XJFOESAGSA-N |
| XLogP | 2.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate?
The IUPAC name of dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate (CID 10020378) is dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate.
What is the SMILES notation for dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate?
The canonical SMILES for dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate is COC(=O)C[C@@H](OC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(=O)OC.
What is the InChIKey of dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate?
The InChIKey is KOHIJQLEVHSPRS-XJFOESAGSA-N. The full InChI is InChI=1S/C17H28O7/c1-10(2)12-7-6-11(3)8-13(12)23-17(20)24-14(16(19)22-5)9-15(18)21-4/h10-14H,6-9H2,1-5H3/t11-,12+,13-,14-/m1/s1.
What are the key properties of dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate?
dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate has a molecular weight of 344.40 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2R)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonyloxybutanedioate is sourced from PubChem (CID 10020378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).