C15H27NO8 — CID 10020716
(2S,4aR,6R,7R,8R,8aR)-6-(5-aminopentoxy)-7-hydroxy-8-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carboxylic acid (PubChem CID 10020716) has the molecular formula C15H27NO8 and a molecular weight of 349.38 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8R,8aR)-6-(5-aminopentoxy)-7-hydroxy-8-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carboxylic acid.
| Compound Name | (2S,4aR,6R,7R,8R,8aR)-6-(5-aminopentoxy)-7-hydroxy-8-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 10020716 |
| Molecular Formula | C15H27NO8 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2S,4aR,6R,7R,8R,8aR)-6-(5-aminopentoxy)-7-hydroxy-8-methoxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carboxylic acid |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](OCCCCCN)O[C@@H]2CO[C@](C)(C(=O)O)O[C@@H]12 |
| InChI | InChI=1S/C15H27NO8/c1-15(14(18)19)22-8-9-11(24-15)12(20-2)10(17)13(23-9)21-7-5-3-4-6-16/h9-13,17H,3-8,16H2,1-2H3,(H,18,19)/t9-,10-,11-,12-,13-,15+/m1/s1 |
| InChIKey | CAAOLQHVTKERMH-RWXDJMAFSA-N |
| XLogP | -0.55 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|