C18H10N2O2S2 — CID 10020784
2-(1,1-dioxo-2-phenyl-6-thiophen-2-ylthiopyran-4-ylidene)propanedinitrile (PubChem CID 10020784) has the molecular formula C18H10N2O2S2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(1,1-dioxo-2-phenyl-6-thiophen-2-ylthiopyran-4-ylidene)propanedinitrile.
| Compound Name | 2-(1,1-dioxo-2-phenyl-6-thiophen-2-ylthiopyran-4-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 10020784 |
| Molecular Formula | C18H10N2O2S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(1,1-dioxo-2-phenyl-6-thiophen-2-ylthiopyran-4-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(c2ccccc2)S(=O)(=O)C(c2cccs2)=C1 |
| InChI | InChI=1S/C18H10N2O2S2/c19-11-15(12-20)14-9-17(13-5-2-1-3-6-13)24(21,22)18(10-14)16-7-4-8-23-16/h1-10H |
| InChIKey | ZTBCMAXJADPXLX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|