C16H19ClN2O3S — CID 1002098
N-[(2-chlorophenyl)carbamothioyl]-3-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propanamide (PubChem CID 1002098) has the molecular formula C16H19ClN2O3S and a molecular weight of 354.86 g/mol. Its IUPAC name is N-[(2-chlorophenyl)carbamothioyl]-3-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propanamide.
| Compound Name | N-[(2-chlorophenyl)carbamothioyl]-3-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 1002098 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[(2-chlorophenyl)carbamothioyl]-3-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propanamide |
| SMILES | CC1(C)C[C@@H](CCC(=O)NC(=S)Nc2ccccc2Cl)C(=O)O1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-16(2)9-10(14(21)22-16)7-8-13(20)19-15(23)18-12-6-4-3-5-11(12)17/h3-6,10H,7-9H2,1-2H3,(H2,18,19,20,23)/t10-/m1/s1 |
| InChIKey | VOOHISAXFJDCGE-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|