C24H27NO3 — CID 10022483
6-[[3-(4-ethyloxan-4-yl)phenoxy]methyl]-1-methylquinolin-2-one (PubChem CID 10022483) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 6-[[3-(4-ethyloxan-4-yl)phenoxy]methyl]-1-methylquinolin-2-one.
| Compound Name | 6-[[3-(4-ethyloxan-4-yl)phenoxy]methyl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 10022483 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6-[[3-(4-ethyloxan-4-yl)phenoxy]methyl]-1-methylquinolin-2-one |
| SMILES | CCC1(c2cccc(OCc3ccc4c(ccc(=O)n4C)c3)c2)CCOCC1 |
| InChI | InChI=1S/C24H27NO3/c1-3-24(11-13-27-14-12-24)20-5-4-6-21(16-20)28-17-18-7-9-22-19(15-18)8-10-23(26)25(22)2/h4-10,15-16H,3,11-14,17H2,1-2H3 |
| InChIKey | JDKMNWTTYKETJR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |