C22H23FN2O4 — CID 14985923
6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinoxalin-2-one (PubChem CID 14985923) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinoxalin-2-one.
| Compound Name | 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinoxalin-2-one |
|---|---|
| PubChem CID | 14985923 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinoxalin-2-one |
| SMILES | COC1(c2cc(F)cc(OCc3ccc4c(c3)ncc(=O)n4C)c2)CCOCC1 |
| InChI | InChI=1S/C22H23FN2O4/c1-25-20-4-3-15(9-19(20)24-13-21(25)26)14-29-18-11-16(10-17(23)12-18)22(27-2)5-7-28-8-6-22/h3-4,9-13H,5-8,14H2,1-2H3 |
| InChIKey | OQGCOMYJISBYJT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |