C24H28FNO7S — CID 11005515
6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinolin-1-ium;methyl sulfate (PubChem CID 11005515) has the molecular formula C24H28FNO7S and a molecular weight of 493.55 g/mol. Its IUPAC name is 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinolin-1-ium;methyl sulfate.
| Compound Name | 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinolin-1-ium;methyl sulfate |
|---|---|
| PubChem CID | 11005515 |
| Molecular Formula | C24H28FNO7S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1-methylquinolin-1-ium;methyl sulfate |
| SMILES | COC1(c2cc(F)cc(OCc3ccc4c(ccc[n+]4C)c3)c2)CCOCC1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C23H25FNO3.CH4O4S/c1-25-9-3-4-18-12-17(5-6-22(18)25)16-28-21-14-19(13-20(24)15-21)23(26-2)7-10-27-11-8-23;1-5-6(2,3)4/h3-6,9,12-15H,7-8,10-11,16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | NYGOVQACNQUNIY-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 98.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|