C25H31FN2O4 — CID 10275147
3-cyclobutyl-1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methylurea (PubChem CID 10275147) has the molecular formula C25H31FN2O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is 3-cyclobutyl-1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methylurea.
| Compound Name | 3-cyclobutyl-1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 10275147 |
| Molecular Formula | C25H31FN2O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-cyclobutyl-1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methylurea |
| SMILES | COC1(c2cc(F)cc(OCc3ccc(N(C)C(=O)NC4CCC4)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C25H31FN2O4/c1-28(24(29)27-21-4-3-5-21)22-8-6-18(7-9-22)17-32-23-15-19(14-20(26)16-23)25(30-2)10-12-31-13-11-25/h6-9,14-16,21H,3-5,10-13,17H2,1-2H3,(H,27,29) |
| InChIKey | CAHBSZXVDPWBHD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |