C26H35FN2O4 — CID 70104480
1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methyl-3-pentylurea (PubChem CID 70104480) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methyl-3-pentylurea.
| Compound Name | 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methyl-3-pentylurea |
|---|---|
| PubChem CID | 70104480 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-1-methyl-3-pentylurea |
| SMILES | CCCCCNC(=O)N(C)c1ccc(COc2cc(F)cc(C3(OC)CCOCC3)c2)cc1 |
| InChI | InChI=1S/C26H35FN2O4/c1-4-5-6-13-28-25(30)29(2)23-9-7-20(8-10-23)19-33-24-17-21(16-22(27)18-24)26(31-3)11-14-32-15-12-26/h7-10,16-18H,4-6,11-15,19H2,1-3H3,(H,28,30) |
| InChIKey | MIUWDXKXPQFRED-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|