C25H27FN2O5 — CID 10275962
1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-3-(furan-2-yl)-1-methylurea (PubChem CID 10275962) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-3-(furan-2-yl)-1-methylurea.
| Compound Name | 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-3-(furan-2-yl)-1-methylurea |
|---|---|
| PubChem CID | 10275962 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[4-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]phenyl]-3-(furan-2-yl)-1-methylurea |
| SMILES | COC1(c2cc(F)cc(OCc3ccc(N(C)C(=O)Nc4ccco4)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C25H27FN2O5/c1-28(24(29)27-23-4-3-11-32-23)21-7-5-18(6-8-21)17-33-22-15-19(14-20(26)16-22)25(30-2)9-12-31-13-10-25/h3-8,11,14-16H,9-10,12-13,17H2,1-2H3,(H,27,29) |
| InChIKey | LVJVFSMTFATDNA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |