C22H24FN3O3 — CID 67091055
[6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]quinolin-2-yl]hydrazine (PubChem CID 67091055) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is [6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]quinolin-2-yl]hydrazine.
| Compound Name | [6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]quinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 67091055 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [6-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]quinolin-2-yl]hydrazine |
| SMILES | COC1(c2cc(F)cc(OCc3ccc4nc(NN)ccc4c3)c2)CCOCC1 |
| InChI | InChI=1S/C22H24FN3O3/c1-27-22(6-8-28-9-7-22)17-11-18(23)13-19(12-17)29-14-15-2-4-20-16(10-15)3-5-21(25-20)26-24/h2-5,10-13H,6-9,14,24H2,1H3,(H,25,26) |
| InChIKey | CAWIINOLIMKBJH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|