C23H24FN3O4 — CID 67091141
methyl 4-[3-fluoro-5-[(2-hydrazinylquinolin-6-yl)methoxy]phenyl]oxane-4-carboxylate (PubChem CID 67091141) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is methyl 4-[3-fluoro-5-[(2-hydrazinylquinolin-6-yl)methoxy]phenyl]oxane-4-carboxylate.
| Compound Name | methyl 4-[3-fluoro-5-[(2-hydrazinylquinolin-6-yl)methoxy]phenyl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 67091141 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | methyl 4-[3-fluoro-5-[(2-hydrazinylquinolin-6-yl)methoxy]phenyl]oxane-4-carboxylate |
| SMILES | COC(=O)C1(c2cc(F)cc(OCc3ccc4nc(NN)ccc4c3)c2)CCOCC1 |
| InChI | InChI=1S/C23H24FN3O4/c1-29-22(28)23(6-8-30-9-7-23)17-11-18(24)13-19(12-17)31-14-15-2-4-20-16(10-15)3-5-21(26-20)27-25/h2-5,10-13H,6-9,14,25H2,1H3,(H,26,27) |
| InChIKey | OPCVGWUKFGCGFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|