C24H26FNO3S — CID 87336405
6-[[3-(4-ethoxyoxan-4-yl)-5-fluorophenoxy]methyl]-1-methylquinoline-2-thione (PubChem CID 87336405) has the molecular formula C24H26FNO3S and a molecular weight of 427.54 g/mol. Its IUPAC name is 6-[[3-(4-ethoxyoxan-4-yl)-5-fluorophenoxy]methyl]-1-methylquinoline-2-thione.
| Compound Name | 6-[[3-(4-ethoxyoxan-4-yl)-5-fluorophenoxy]methyl]-1-methylquinoline-2-thione |
|---|---|
| PubChem CID | 87336405 |
| Molecular Formula | C24H26FNO3S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 6-[[3-(4-ethoxyoxan-4-yl)-5-fluorophenoxy]methyl]-1-methylquinoline-2-thione |
| SMILES | CCOC1(c2cc(F)cc(OCc3ccc4c(ccc(=S)n4C)c3)c2)CCOCC1 |
| InChI | InChI=1S/C24H26FNO3S/c1-3-29-24(8-10-27-11-9-24)19-13-20(25)15-21(14-19)28-16-17-4-6-22-18(12-17)5-7-23(30)26(22)2/h4-7,12-15H,3,8-11,16H2,1-2H3 |
| InChIKey | BFILUKDXZQUSAJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|