C21H25FO3 — CID 67798074
4-ethoxy-4-(3-fluoro-5-phenylmethoxyphenyl)-2-methyloxane (PubChem CID 67798074) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-ethoxy-4-(3-fluoro-5-phenylmethoxyphenyl)-2-methyloxane.
| Compound Name | 4-ethoxy-4-(3-fluoro-5-phenylmethoxyphenyl)-2-methyloxane |
|---|---|
| PubChem CID | 67798074 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-ethoxy-4-(3-fluoro-5-phenylmethoxyphenyl)-2-methyloxane |
| SMILES | CCOC1(c2cc(F)cc(OCc3ccccc3)c2)CCOC(C)C1 |
| InChI | InChI=1S/C21H25FO3/c1-3-25-21(9-10-23-16(2)14-21)18-11-19(22)13-20(12-18)24-15-17-7-5-4-6-8-17/h4-8,11-13,16H,3,9-10,14-15H2,1-2H3 |
| InChIKey | BQENGYBCYFLPAS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |