C23H38N2O2Si — CID 10024078
ethyl (2S,3R)-2-amino-3-[1-tri(propan-2-yl)silylindol-3-yl]butanoate (PubChem CID 10024078) has the molecular formula C23H38N2O2Si and a molecular weight of 402.66 g/mol. Its IUPAC name is ethyl (2S,3R)-2-amino-3-[1-tri(propan-2-yl)silylindol-3-yl]butanoate.
| Compound Name | ethyl (2S,3R)-2-amino-3-[1-tri(propan-2-yl)silylindol-3-yl]butanoate |
|---|---|
| PubChem CID | 10024078 |
| Molecular Formula | C23H38N2O2Si |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | ethyl (2S,3R)-2-amino-3-[1-tri(propan-2-yl)silylindol-3-yl]butanoate |
| SMILES | CCOC(=O)[C@@H](N)[C@H](C)c1cn([Si](C(C)C)(C(C)C)C(C)C)c2ccccc12 |
| InChI | InChI=1S/C23H38N2O2Si/c1-9-27-23(26)22(24)18(8)20-14-25(21-13-11-10-12-19(20)21)28(15(2)3,16(4)5)17(6)7/h10-18,22H,9,24H2,1-8H3/t18-,22+/m1/s1 |
| InChIKey | POCJWARCHUFRKQ-GCJKJVERSA-N |
| XLogP | 5.66 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|