C20H27NO4 — CID 100981876
diethyl 2-[2-(1,3-dimethylindol-2-yl)propyl]propanedioate (PubChem CID 100981876) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is diethyl 2-[2-(1,3-dimethylindol-2-yl)propyl]propanedioate.
| Compound Name | diethyl 2-[2-(1,3-dimethylindol-2-yl)propyl]propanedioate |
|---|---|
| PubChem CID | 100981876 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | diethyl 2-[2-(1,3-dimethylindol-2-yl)propyl]propanedioate |
| SMILES | CCOC(=O)C(CC(C)c1c(C)c2ccccc2n1C)C(=O)OCC |
| InChI | InChI=1S/C20H27NO4/c1-6-24-19(22)16(20(23)25-7-2)12-13(3)18-14(4)15-10-8-9-11-17(15)21(18)5/h8-11,13,16H,6-7,12H2,1-5H3 |
| InChIKey | VAVQDPTXSJUHTF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|